EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N4O3 |
| Net Charge | 0 |
| Average Mass | 348.362 |
| Monoisotopic Mass | 348.12224 |
| SMILES | Oc1cccc(-c2nc(N3CCOCC3)c3oc4ncccc4c3n2)c1 |
| InChI | InChI=1S/C19H16N4O3/c24-13-4-1-3-12(11-13)17-21-15-14-5-2-6-20-19(14)26-16(15)18(22-17)23-7-9-25-10-8-23/h1-6,11,24H,7-10H2 |
| InChIKey | TUVCWJQQGGETHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PI-103 (CHEBI:90524) has role antineoplastic agent (CHEBI:35610) |
| PI-103 (CHEBI:90524) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| PI-103 (CHEBI:90524) has role mTOR inhibitor (CHEBI:68481) |
| PI-103 (CHEBI:90524) is a aromatic amine (CHEBI:33860) |
| PI-103 (CHEBI:90524) is a morpholines (CHEBI:38785) |
| PI-103 (CHEBI:90524) is a organic heterotricyclic compound (CHEBI:26979) |
| PI-103 (CHEBI:90524) is a phenols (CHEBI:33853) |
| PI-103 (CHEBI:90524) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[4-(morpholin-4-yl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenol |
| Synonyms | Source |
|---|---|
| pi-103 | ChemIDplus |
| PIK-103 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11065715 | Reaxys |
| CAS:371935-74-9 | ChemIDplus |
| Citations |
|---|