EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N4O3 |
| Net Charge | 0 |
| Average Mass | 348.362 |
| Monoisotopic Mass | 348.12224 |
| SMILES | Oc1cccc(-c2nc(N3CCOCC3)c3oc4ncccc4c3n2)c1 |
| InChI | InChI=1S/C19H16N4O3/c24-13-4-1-3-12(11-13)17-21-15-14-5-2-6-20-19(14)26-16(15)18(22-17)23-7-9-25-10-8-23/h1-6,11,24H,7-10H2 |
| InChIKey | TUVCWJQQGGETHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PI-103 (CHEBI:90524) has role antineoplastic agent (CHEBI:35610) |
| PI-103 (CHEBI:90524) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| PI-103 (CHEBI:90524) has role mTOR inhibitor (CHEBI:68481) |
| PI-103 (CHEBI:90524) is a aromatic amine (CHEBI:33860) |
| PI-103 (CHEBI:90524) is a morpholines (CHEBI:38785) |
| PI-103 (CHEBI:90524) is a organic heterotricyclic compound (CHEBI:26979) |
| PI-103 (CHEBI:90524) is a phenols (CHEBI:33853) |
| PI-103 (CHEBI:90524) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[4-(morpholin-4-yl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenol |
| Synonyms | Source |
|---|---|
| pi-103 | ChemIDplus |
| PIK-103 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11065715 | Reaxys |
| CAS:371935-74-9 | ChemIDplus |
| Citations |
|---|