EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26N3O3S.Na |
| Net Charge | 0 |
| Average Mass | 555.635 |
| Monoisotopic Mass | 555.15926 |
| SMILES | Cc1cc(C(=C2C=CC(=Nc3ccccc3)C=C2)c2ccc(Nc3ccccc3S(=O)(=O)[O-])cc2)ccc1N.[Na+] |
| InChI | InChI=1S/C32H27N3O3S.Na/c1-22-21-25(15-20-29(22)33)32(23-11-16-27(17-12-23)34-26-7-3-2-4-8-26)24-13-18-28(19-14-24)35-30-9-5-6-10-31(30)39(36,37)38;/h2-21,35H,33H2,1H3,(H,36,37,38);/q;+1/p-1/b32-23-,34-27+; |
| InChIKey | AOADSHDCARXSGL-ZMIIQOOPSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alkali blue 4B (CHEBI:90522) has part 2-(4-{(4-amino-3-methylphenyl)[4-(phenylimino)cyclohexa-2,5-dien-1-ylidene]methyl}anilino)benzene-1-sulfonate (CHEBI:90534) |
| alkali blue 4B (CHEBI:90522) has role fluorochrome (CHEBI:51217) |
| alkali blue 4B (CHEBI:90522) has role histological dye (CHEBI:77178) |
| alkali blue 4B (CHEBI:90522) is a organic sodium salt (CHEBI:38700) |
| alkali blue 4B (CHEBI:90522) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| sodium 2-(4-{(4-amino-3-methylphenyl)[4-(phenylimino)cyclohexa-2,5-dien-1-ylidene]methyl}anilino)benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| acid blue 110 | ChEBI |
| alkali blue | ChEBI |
| C.I. 42750 | ChEBI |
| Sodium ((4-((4-amino-m-tolyl)(4-(phenylimino)cyclohexa-2,5-dien-1-ylidene)methyl)phenyl)amino)benzenesulphonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:62152-67-4 | ChemIDplus |