EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32N3.Cl |
| Net Charge | 0 |
| Average Mass | 458.049 |
| Monoisotopic Mass | 457.22848 |
| SMILES | CCNc1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)c2ccccc12.[Cl-] |
| InChI | InChI=1S/C29H31N3.ClH/c1-6-30-28-20-19-27(25-9-7-8-10-26(25)28)29(21-11-15-23(16-12-21)31(2)3)22-13-17-24(18-14-22)32(4)5;/h7-20H,6H2,1-5H3;1H |
| InChIKey | JEVGKYBUANQAKG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| victoria blue R (CHEBI:90518) has part victoria blue R(1+) (CHEBI:90520) |
| victoria blue R (CHEBI:90518) has role fluorochrome (CHEBI:51217) |
| victoria blue R (CHEBI:90518) has role histological dye (CHEBI:77178) |
| victoria blue R (CHEBI:90518) is a iminium salt (CHEBI:35277) |
| victoria blue R (CHEBI:90518) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{[4-(dimethylamino)phenyl][4-(ethylamino)naphthalen-1-yl]methylidene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| basic blue 11 | ChEBI |
| victoria blue | ChEBI |
| C.I. 44040 | ChEBI |
| CI 44040 | ChemIDplus |
| Basic blue K | ChemIDplus |
| C.I. Basic Blue 11 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Victoria_blue_R | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3898694 | Reaxys |
| CAS:2185-86-6 | ChemIDplus |