EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC[C@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1 |
| InChIKey | MMDUKUSNQNWVET-VYUBKLCTSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antinematodal drug A substance used in the treatment or control of nematode infestations. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schaftoside (CHEBI:9047) has functional parent apigenin (CHEBI:18388) |
| schaftoside (CHEBI:9047) has role antinematodal drug (CHEBI:35444) |
| schaftoside (CHEBI:9047) has role antioxidant (CHEBI:22586) |
| schaftoside (CHEBI:9047) is a C-glycosyl compound (CHEBI:20857) |
| schaftoside (CHEBI:9047) is a trihydroxyflavone (CHEBI:27116) |
| Synonyms | Source |
|---|---|
| Schaftoside | KEGG COMPOUND |
| 8α-L-arabinopyranosyl-6β-D-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-Benzopyran-4-one | ChEBI |
| apigenin 6-C-β-D-glucopyranosyl-8-C-α-L-arabinopyranoside | ChEBI |
| 6-C-β-glucopyranosyl-8-C-α-arabinopyranosylapigenin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10181 | KEGG COMPOUND |
| LMPK12110207 | LIPID MAPS |
| CN101773584 | Patent |
| C00006177 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1416363 | Reaxys |
| CAS:51938-32-0 | KEGG COMPOUND |
| CAS:51938-32-0 | ChemIDplus |
| Citations |
|---|