EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N2O3 |
| Net Charge | -1 |
| Average Mass | 271.296 |
| Monoisotopic Mass | 271.10882 |
| SMILES | N[C@@H](CCC(=O)Nc1ccc2ccccc2c1)C(=O)[O-] |
| InChI | InChI=1S/C15H16N2O3/c16-13(15(19)20)7-8-14(18)17-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8,16H2,(H,17,18)(H,19,20)/p-1/t13-/m0/s1 |
| InChIKey | XWCSDVVHAXLZNL-ZDUSSCGKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(γ-L-glutamyl)-2-naphthylamine(1−) (CHEBI:90443) is a L-α-amino acid anion (CHEBI:59814) |
| N-(γ-L-glutamyl)-2-naphthylamine(1−) (CHEBI:90443) is conjugate base of N-(γ-L-glutamyl)-2-naphthylamine (CHEBI:90444) |
| Incoming Relation(s) |
| N-(γ-L-glutamyl)-2-naphthylamine (CHEBI:90444) is conjugate acid of N-(γ-L-glutamyl)-2-naphthylamine(1−) (CHEBI:90443) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[(naphthalen-2-yl)amino]-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| N-(2-naphthyl)-L-glutaminate | ChEBI |
| N-(β-naphthyl)-L-glutaminate | ChEBI |
| L-glutamate γ-2-naphthylamide | ChEBI |