EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | O=C1OC[C@H](Cc2ccc3c(c2)OCO3)/C1=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H16O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,6-8,14H,5,9-11H2/b15-6+/t14-/m0/s1 |
| InChIKey | CMJGAYUQSLJSCR-ULIPXBITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthopanax henryi (IPNI:89458-1) | Root (BTO:0001188) | PubMed (30915141) | |
| Amyris pinnata (ncbitaxon:1123434) | leaf (BTO:0000713) | DOI (10.1021/np50015a016) | |
| Chamaecyparis formosensis (ncbitaxon:187461) | - | PubMed (17291735) | |
| Eleutherococcus divaricatus var. chiisanensis (ncbitaxon:96666) | Root (BTO:0001188) | PubMed (12392817) | Species also known as Acanthopanax chiisanensis. |
| Eleutherococcus sessiliflorus (ncbitaxon:105886) | - | PubMed (22497733) | Species also known as Acanthopanax sessiliflorus. |
| Hydrocotyle umbellata (ncbitaxon:1475409) | - | PubMed (28903179) | |
| Hypoestes aristata (ncbitaxon:141314) | stem (BTO:0001300) | PubMed (32786879) | |
| Pterocarpus santalinus (ncbitaxon:1071199) | - | PubMed (11217086) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. T-cell proliferation inhibitor An inhibitor that interferes with the process of T-cell proliferation. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| savinin (CHEBI:9044) has role anti-inflammatory agent (CHEBI:67079) |
| savinin (CHEBI:9044) has role anticoronaviral agent (CHEBI:149553) |
| savinin (CHEBI:9044) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| savinin (CHEBI:9044) has role plant metabolite (CHEBI:76924) |
| savinin (CHEBI:9044) has role T-cell proliferation inhibitor (CHEBI:63173) |
| savinin (CHEBI:9044) is a benzodioxoles (CHEBI:38298) |
| savinin (CHEBI:9044) is a lignan (CHEBI:25036) |
| savinin (CHEBI:9044) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3E,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-(1,3-benzodioxol-5-ylmethylidene)dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| (3E,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-(1,3-benzodioxol-5-ylmethylene)dihydro-2(3H)-furanone | ChEBI |
| (3E,4R)-4-[(2H-1,3-benzodioxol-5-yl)methyl]-3-[(2H-1,3-benzodioxol-5-yl)methylidene]oxolan-2-one | IUPAC |
| (−)-hibalactone | KNApSAcK |
| hibalactone | ChEBI |
| (−)-savinin | KNApSAcK |
| savinin | KEGG COMPOUND |
| Citations |
|---|