EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N2O3 |
| Net Charge | -1 |
| Average Mass | 271.296 |
| Monoisotopic Mass | 271.10882 |
| SMILES | N[C@@H](CCC(=O)[O-])C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16N2O3/c16-13(7-8-14(18)19)15(20)17-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8,16H2,(H,17,20)(H,18,19)/p-1/t13-/m0/s1 |
| InChIKey | KRHKZHQADOKBFO-ZDUSSCGKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(α-L-glutamyl)-2-naphthylamine(1−) (CHEBI:90439) is a γ-amino acid anion (CHEBI:71666) |
| N-(α-L-glutamyl)-2-naphthylamine(1−) (CHEBI:90439) is conjugate base of N-(α-L-glutamyl)-2-naphthylamine (CHEBI:90440) |
| Incoming Relation(s) |
| N-(α-L-glutamyl)-2-naphthylamine (CHEBI:90440) is conjugate acid of N-(α-L-glutamyl)-2-naphthylamine(1−) (CHEBI:90439) |
| IUPAC Name |
|---|
| 2-[(5-oxidanidyl-5-oxidanylidene-L-norvalyl)amino]naphthalene |
| Synonyms | Source |
|---|---|
| L-glutamate β-naphthylamide | ChEBI |
| L-glutamate 2-naphthylamide | ChEBI |
| (4S)-4-amino-5-[(naphthalen-2-yl)amino]-5-oxopentanoate | IUPAC |