EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2OS |
| Net Charge | 0 |
| Average Mass | 274.389 |
| Monoisotopic Mass | 274.11398 |
| SMILES | CSCC[C@@H](N)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H18N2OS/c1-19-9-8-14(16)15(18)17-13-7-6-11-4-2-3-5-12(11)10-13/h2-7,10,14H,8-9,16H2,1H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | CHWHUPKCZKLQIM-CQSZACIVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-methionine 2-naphthylamide (CHEBI:90423) is a D-methionine derivative (CHEBI:84122) |
| D-methionine 2-naphthylamide (CHEBI:90423) is a 2-amino-4-(methylsulfanyl)-N-(2-naphthyl)butanamide (CHEBI:90421) |
| D-methionine 2-naphthylamide (CHEBI:90423) is enantiomer of L-methionine 2-naphthylamide (CHEBI:90422) |
| Incoming Relation(s) |
| DL-methionine 2-naphthylamide (CHEBI:90346) has part D-methionine 2-naphthylamide (CHEBI:90423) |
| L-methionine 2-naphthylamide (CHEBI:90422) is enantiomer of D-methionine 2-naphthylamide (CHEBI:90423) |
| IUPAC Name |
|---|
| N-naphthalen-2-yl-D-methioninamide |
| Synonym | Source |
|---|---|
| D-methionine β-naphthylamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21067499 | Reaxys |