EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N2O.Cl4Fe |
| Net Charge | 0 |
| Average Mass | 521.117 |
| Monoisotopic Mass | 519.02269 |
| SMILES | CCN(CC)c1ccc2cc3ccc(=[N+](CC)CC)cc-3oc2c1.[Cl][Fe-]([Cl])([Cl])[Cl] |
| InChI | InChI=1S/C21H27N2O.4ClH.Fe/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18;;;;;/h9-15H,5-8H2,1-4H3;4*1H;/q+1;;;;;+3/p-4 |
| InChIKey | SUVPQRYDMCNTPV-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyronin B-FeCl3 complex (CHEBI:90411) has part pyronin B(1+) (CHEBI:90410) |
| pyronin B-FeCl3 complex (CHEBI:90411) has part tetrachloroferrate(1−) (CHEBI:30811) |
| pyronin B-FeCl3 complex (CHEBI:90411) has role histological dye (CHEBI:77178) |
| pyronin B-FeCl3 complex (CHEBI:90411) is a iminium salt (CHEBI:35277) |
| pyronin B-FeCl3 complex (CHEBI:90411) is a iron coordination entity (CHEBI:33892) |
| IUPAC Name |
|---|
| 6-(diethylamino)-N,N-diethyl-3H-xanthen-3-iminium tetrachloroferrate(1−) |
| Synonyms | Source |
|---|---|
| C.l. 45010 | ChEBI |
| pyronin B-iron(III) chloride complex | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3846969 | Reaxys |