EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N2O.Cl |
| Net Charge | 0 |
| Average Mass | 358.913 |
| Monoisotopic Mass | 358.18119 |
| SMILES | CCN(CC)c1ccc2cc3ccc(=[N+](CC)CC)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C21H27N2O.ClH/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18;/h9-15H,5-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | CXZRDVVUVDYSCQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyronin B (CHEBI:90405) has part pyronin B(1+) (CHEBI:90410) |
| pyronin B (CHEBI:90405) has role histological dye (CHEBI:77178) |
| pyronin B (CHEBI:90405) is a iminium salt (CHEBI:35277) |
| pyronin B (CHEBI:90405) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 6-(diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride |
| Synonyms | Source |
|---|---|
| Pyronine B | ChemIDplus |
| C.I. 45010 | ChEBI |
| (6-(Diethylamino)-3H-xanthen-3-ylidine)diethylammonium chloride | ChemIDplus |
| N-(6-(Diethylamino)-3H-xanthen-3-ylidine)-N-ethylethanaminium chloride | ChemIDplus |
| 3,6-Bis(diethylamino)xanthylium chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5421772 | Reaxys |
| CAS:2150-48-3 | ChemIDplus |
| Citations |
|---|