EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15N3O3S3 |
| Net Charge | 0 |
| Average Mass | 453.570 |
| Monoisotopic Mass | 453.02755 |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(N)cc5)sc4c3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C21H15N3O3S3/c1-11-2-8-16-18(19(11)30(25,26)27)29-21(24-16)13-5-9-15-17(10-13)28-20(23-15)12-3-6-14(22)7-4-12/h2-10H,22H2,1H3,(H,25,26,27) |
| InChIKey | CTPFWVHDVOKBSN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primuline (acid form) (CHEBI:90402) has role fluorochrome (CHEBI:51217) |
| primuline (acid form) (CHEBI:90402) has role histological dye (CHEBI:77178) |
| primuline (acid form) (CHEBI:90402) is a arenesulfonic acid (CHEBI:33555) |
| primuline (acid form) (CHEBI:90402) is a benzothiazoles (CHEBI:37947) |
| primuline (acid form) (CHEBI:90402) is a ring assembly (CHEBI:36820) |
| primuline (acid form) (CHEBI:90402) is a substituted aniline (CHEBI:48975) |
| primuline (acid form) (CHEBI:90402) is conjugate acid of 2'-(4-aminophenyl)-6-methyl[2,6'-bi-1,3-benzothiazole]-7-sulfonate (CHEBI:90403) |
| Incoming Relation(s) |
| 2'-(4-aminophenyl)-6-methyl[2,6'-bi-1,3-benzothiazole]-7-sulfonate (CHEBI:90403) is conjugate base of primuline (acid form) (CHEBI:90402) |
| IUPAC Name |
|---|
| 2'-(4-aminophenyl)-6-methyl[2,6'-bi-1,3-benzothiazole]-7-sulfonic acid |
| Synonyms | Source |
|---|---|
| primuline free acid | ChEBI |
| 2-(4-Aminophenyl)-6-methyl(2,6'-bibenzothiazole)-7-sulphonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1054662 | Reaxys |
| CAS:5855-97-0 | ChemIDplus |