EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H14N3O3S3.Na |
| Net Charge | 0 |
| Average Mass | 475.552 |
| Monoisotopic Mass | 475.00950 |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(N)cc5)sc4c3)sc2c1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H15N3O3S3.Na/c1-11-2-8-16-18(19(11)30(25,26)27)29-21(24-16)13-5-9-15-17(10-13)28-20(23-15)12-3-6-14(22)7-4-12;/h2-10H,22H2,1H3,(H,25,26,27);/q;+1/p-1 |
| InChIKey | RSRNHSYYBLEMOI-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primuline (CHEBI:90399) has part 2'-(4-aminophenyl)-6-methyl[2,6'-bi-1,3-benzothiazole]-7-sulfonate (CHEBI:90403) |
| primuline (CHEBI:90399) has role fluorochrome (CHEBI:51217) |
| primuline (CHEBI:90399) has role histological dye (CHEBI:77178) |
| primuline (CHEBI:90399) is a organic sodium salt (CHEBI:38700) |
| primuline (CHEBI:90399) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| sodium 2'-(4-aminophenyl)-6-methyl[2,6'-bi-1,3-benzothiazole]-7-sulfonate |
| Synonyms | Source |
|---|---|
| C.I. 49000 | ChEBI |
| C.I. Direct Yellow 59, monosodium salt | ChemIDplus |
| direct yellow 59 | ChEBI |
| NSC 143368 | ChemIDplus |
| NSC143368 | ChemIDplus |
| Sodium 2'-(4-aminophenyl)-6-methyl(2,6'-bibenzothiazole)-7-sulphonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Primuline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23566367 | Reaxys |
| CAS:10360-31-3 | ChemIDplus |
| Citations |
|---|