EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35NO5 |
| Net Charge | 0 |
| Average Mass | 477.601 |
| Monoisotopic Mass | 477.25152 |
| SMILES | O=C(O)CC/C=C\CC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C29H35NO5/c31-26-20-27(35-21-22-12-14-24(15-13-22)23-8-4-3-5-9-23)25(10-6-1-2-7-11-28(32)33)29(26)30-16-18-34-19-17-30/h1-5,8-9,12-15,25,27,29H,6-7,10-11,16-21H2,(H,32,33)/b2-1-/t25-,27-,29+/m0/s1 |
| InChIKey | IOFUFYLETVNNRF-OSAZKUMMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2R,5S)-AH23848 (CHEBI:90389) is a (4Z)-7-{5-[([1,1'-biphenyl]-4-yl)methoxy]-2-(morpholin-4-yl)-3-oxocyclopentyl}hept-4-enoic acid (CHEBI:90393) |
| (1R,2R,5S)-AH23848 (CHEBI:90389) is conjugate acid of (1R,2R,5S)-AH23848(1−) (CHEBI:90394) |
| (1R,2R,5S)-AH23848 (CHEBI:90389) is enantiomer of (1S,2S,5R)-AH23848 (CHEBI:90391) |
| Incoming Relation(s) |
| AH23848 (CHEBI:90388) has part (1R,2R,5S)-AH23848 (CHEBI:90389) |
| (1R,2R,5S)-AH23848(1−) (CHEBI:90394) is conjugate base of (1R,2R,5S)-AH23848 (CHEBI:90389) |
| (1S,2S,5R)-AH23848 (CHEBI:90391) is enantiomer of (1R,2R,5S)-AH23848 (CHEBI:90389) |
| IUPAC Name |
|---|
| (4Z)-7-[(1R,2R,5S)-5-[([1,1'-biphenyl]-4-yl)methoxy]-2-(morpholin-4-yl)-3-oxocyclopentyl]hept-4-enoic acid |
| Synonym | Source |
|---|---|
| (−)-AH 23848 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11714447 | Reaxys |