EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C29H34NO5.Ca |
| Net Charge | 0 |
| Average Mass | 993.264 |
| Monoisotopic Mass | 992.44999 |
| SMILES | O=C([O-])CC/C=C\CC[C@H]1[C@H](N2CCOCC2)C(=O)C[C@H]1OCc1ccc(-c2ccccc2)cc1.O=C([O-])CC/C=C\CC[C@H]1[C@H](N2CCOCC2)C(=O)C[C@H]1OCc1ccc(-c2ccccc2)cc1.[Ca+2] |
| InChI | InChI=1S/2C29H35NO5.Ca/c2*31-26-20-27(35-21-22-12-14-24(15-13-22)23-8-4-3-5-9-23)25(10-6-1-2-7-11-28(32)33)29(26)30-16-18-34-19-17-30;/h2*1-5,8-9,12-15,25,27,29H,6-7,10-11,16-21H2,(H,32,33);/q;;+2/p-2/b2*2-1-;/t2*25-,27-,29+;/m11./s1 |
| InChIKey | JDEBIDDIERGZQY-XVFRBOAOSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2S,5R)-AH23848 hemicalcium salt (CHEBI:90387) has part (1S,2S,5R)-AH23848(1−) (CHEBI:90395) |
| (1S,2S,5R)-AH23848 hemicalcium salt (CHEBI:90387) is a organic calcium salt (CHEBI:51031) |
| (1S,2S,5R)-AH23848 hemicalcium salt (CHEBI:90387) is enantiomer of (1R,2R,5S)-AH23848 hemicalcium salt (CHEBI:90386) |
| Incoming Relation(s) |
| AH23848 hemicalcium salt (CHEBI:90261) has part (1S,2S,5R)-AH23848 hemicalcium salt (CHEBI:90387) |
| (1R,2R,5S)-AH23848 hemicalcium salt (CHEBI:90386) is enantiomer of (1S,2S,5R)-AH23848 hemicalcium salt (CHEBI:90387) |
| IUPAC Name |
|---|
| calcium bis{(4Z)-7-[(1S,2S,5R)-5-[([1,1'-biphenyl]-4-yl)methoxy]-2-(morpholin-4-yl)-3-oxocyclopentyl]hept-4-enoate} |