EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO6S |
| Net Charge | 0 |
| Average Mass | 261.255 |
| Monoisotopic Mass | 261.03071 |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)NS(=O)(=O)O |
| InChI | InChI=1S/C9H11NO6S/c11-7-3-1-6(2-4-7)5-8(9(12)13)10-17(14,15)16/h1-4,8,10-11H,5H2,(H,12,13)(H,14,15,16)/t8-/m0/s1 |
| InChIKey | HFDZHKBVRYIMOG-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS222) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-sulfotyrosine (CHEBI:90373) has functional parent sulfamic acid (CHEBI:9330) |
| N-sulfotyrosine (CHEBI:90373) is a N-acyl-L-tyrosine (CHEBI:90090) |
| IUPAC Name |
|---|
| N-sulfo-L-tyrosine |