EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2D4O4 |
| Net Charge | 0 |
| Average Mass | 122.112 |
| Monoisotopic Mass | 122.05172 |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/i1D2,2D2 |
| InChIKey | KDYFGRWQOYBRFD-LNLMKGTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS225) | |
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinic acid-d4 (CHEBI:90372) is a C4-dicarboxylic acid (CHEBI:66873) |
| succinic acid-d4 (CHEBI:90372) is a deuterated compound (CHEBI:76107) |
| succinic acid-d4 (CHEBI:90372) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| (2H4)butanedioic acid |
| Synonyms | Source |
|---|---|
| 2,2,3,3-tetradeuteriosuccinic acid | ChEBI |
| succinic acid-2,2,3,3-d4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1781784 | Reaxys |