EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46N7O17P3S |
| Net Charge | 0 |
| Average Mass | 877.697 |
| Monoisotopic Mass | 877.18837 |
| SMILES | CCCC=C(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C28H46N7O17P3S/c1-5-6-7-16(2)27(40)56-11-10-30-18(36)8-9-31-25(39)22(38)28(3,4)13-49-55(46,47)52-54(44,45)48-12-17-21(51-53(41,42)43)20(37)26(50-17)35-15-34-19-23(29)32-14-33-24(19)35/h7,14-15,17,20-22,26,37-38H,5-6,8-13H2,1-4H3,(H,30,36)(H,31,39)(H,44,45)(H,46,47)(H2,29,32,33)(H2,41,42,43)/t17-,20-,21-,22+,26-/m1/s1 |
| InChIKey | MIAFVRYGHZDNEJ-TYHXJLICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (7698750) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhexenoyl-CoA (CHEBI:90362) has role human metabolite (CHEBI:77746) |
| 2-methylhexenoyl-CoA (CHEBI:90362) is a 2-enoyl-CoA (CHEBI:19573) |
| 2-methylhexenoyl-CoA (CHEBI:90362) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| 2-methylhexenoyl-CoA (CHEBI:90362) is a methyl-branched fatty acyl-CoA (CHEBI:25271) |
| 2-methylhexenoyl-CoA (CHEBI:90362) is a monounsaturated fatty acyl-CoA (CHEBI:139575) |
| 2-methylhexenoyl-CoA (CHEBI:90362) is conjugate acid of 2-methylhexenoyl-CoA(4−) (CHEBI:90157) |
| Incoming Relation(s) |
| 2-methylhexenoyl-CoA(4−) (CHEBI:90157) is conjugate base of 2-methylhexenoyl-CoA (CHEBI:90362) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methylhexenoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} |
| Synonym | Source |
|---|---|
| 2-methylhexenoyl-coenzyme A | ChEBI |
| Citations |
|---|