EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N3O4 |
| Net Charge | 0 |
| Average Mass | 293.323 |
| Monoisotopic Mass | 293.13756 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19N3O4/c15-10(8-9-4-2-1-3-5-9)13(19)17-11(14(20)21)6-7-12(16)18/h1-5,10-11H,6-8,15H2,(H2,16,18)(H,17,19)(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | KLAONOISLHWJEE-QWRGUYRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS222) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Gln (CHEBI:90354) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-glutamine |
| Synonyms | Source |
|---|---|
| phenylalanylglutamine | ChEBI |
| L-Phe-L-Gln | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028993 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2766970 | Reaxys |