EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O3 |
| Net Charge | 0 |
| Average Mass | 232.239 |
| Monoisotopic Mass | 232.08479 |
| SMILES | O=C(O)CNC(=O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C12H12N2O3/c15-11(14-7-12(16)17)5-8-6-13-10-4-2-1-3-9(8)10/h1-4,6,13H,5,7H2,(H,14,15)(H,16,17) |
| InChIKey | YDXXLJMIHMIOIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS48) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indol-3-ylacetyl)glycine (CHEBI:90332) is a N-acylglycine (CHEBI:16180) |
| N-(indol-3-ylacetyl)glycine (CHEBI:90332) is a indoleacetic acid amide conjugate (CHEBI:64632) |
| IUPAC Name |
|---|
| N-[(1H-indol-3-yl)acetyl]glycine |
| Synonyms | Source |
|---|---|
| N-(1H-indol-3-ylacetyl)glycine | PDBeChem |
| N-indoleacetylglycine | ChEBI |