EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O4 |
| Net Charge | 0 |
| Average Mass | 218.253 |
| Monoisotopic Mass | 218.12666 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C9H18N2O4/c1-3-5(2)7(9(14)15)11-8(13)6(10)4-12/h5-7,12H,3-4,10H2,1-2H3,(H,11,13)(H,14,15)/t5-,6-,7-/m0/s1 |
| InChIKey | BXLYSRPHVMCOPS-ACZMJKKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS222) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Ile (CHEBI:90326) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-isoleucine |
| Synonyms | Source |
|---|---|
| seryl-isoleucine | ChEBI |
| SI | ChEBI |
| serylisoleucine | ChEBI |
| L-Ser-L-Ile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029042 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1712189 | Reaxys |