EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N4O13S4 |
| Net Charge | 0 |
| Average Mass | 672.653 |
| Monoisotopic Mass | 671.95967 |
| SMILES | O=S(=O)(O)c1ccc(N=Nc2ccc(N=Nc3c(O)c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H16N4O13S4/c27-22-20(43(37,38)39)10-12-9-16(41(31,32)33)6-7-17(12)21(22)26-25-18-8-3-14(11-19(18)42(34,35)36)24-23-13-1-4-15(5-2-13)40(28,29)30/h1-11,27H,(H,28,29,30)(H,31,32,33)(H,34,35,36)(H,37,38,39) |
| InChIKey | KMNTUASVUKNVJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ponceau S (acid form) (CHEBI:90322) has role fluorochrome (CHEBI:51217) |
| Ponceau S (acid form) (CHEBI:90322) has role histological dye (CHEBI:77178) |
| Ponceau S (acid form) (CHEBI:90322) is a arenesulfonic acid (CHEBI:33555) |
| Ponceau S (acid form) (CHEBI:90322) is a azobenzenes (CHEBI:22682) |
| Ponceau S (acid form) (CHEBI:90322) is a bis(azo) compound (CHEBI:48960) |
| Ponceau S (acid form) (CHEBI:90322) is a naphthols (CHEBI:25392) |
| Ponceau S (acid form) (CHEBI:90322) is conjugate acid of Ponceau S(4−) (CHEBI:90323) |
| Incoming Relation(s) |
| Ponceau S(4−) (CHEBI:90323) is conjugate base of Ponceau S (acid form) (CHEBI:90322) |
| IUPAC Name |
|---|
| 3-hydroxy-4-({2-sulfo-4-[(4-sulfophenyl)diazenyl]phenyl}diazenyl)naphthalene-2,7-disulfonic acid |
| Synonym | Source |
|---|---|
| Ponceau S free acid | ChEBI |