EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(O)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9NO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-2,4-5H,3,6H2,(H,11,12) |
| InChIKey | VZOPVJNBOQOLPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(p-nitrophenyl)propanoic acid (CHEBI:90321) has functional parent 3-phenylpropionic acid (CHEBI:28631) |
| 3-(p-nitrophenyl)propanoic acid (CHEBI:90321) has role chromogenic compound (CHEBI:75050) |
| 3-(p-nitrophenyl)propanoic acid (CHEBI:90321) is a C-nitro compound (CHEBI:35716) |
| 3-(p-nitrophenyl)propanoic acid (CHEBI:90321) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(4-nitrophenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| β-(4-nitrophenyl)propionic acid | ChEBI |
| 3-(4-nitrophenyl)propionic acid | ChEBI |
| 3-(p-nitrophenyl)propionic acid | ChEBI |
| β-(p-nitrophenyl)propionic acid | ChEBI |
| β-(p-nitrophenyl)propanoic acid | ChEBI |
| β-(4-nitrophenyl)propanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:16642-79-8 | ChemIDplus |