EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9032 - Sarmentoloside
| Formula | C29H44O11 |
| Net Charge | 0 |
| Average Mass | 568.660 |
| Monoisotopic Mass | 568.28836 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O[C@@H]4O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]4O)CC[C@]3(CO)[C@@]1([H])[C@H](O)C[C@@]1(C)[C@]2(O)CC[C@]1([H])C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H44O11/c1-14-22(33)23(34)24(35)25(39-14)40-16-3-6-27(13-30)21-18(4-7-28(27,36)10-16)29(37)8-5-17(15-9-20(32)38-12-15)26(29,2)11-19(21)31/h9,14,16-19,21-25,30-31,33-37H,3-8,10-13H2,1-2H3/t14-,16-,17+,18+,19+,21+,22+,23+,24+,25-,26+,27-,28-,29-/m0/s1 |
| InChIKey | BUGNRCRUPAIYMD-VBVNMADNSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sarmentoloside (CHEBI:9032) is a cardenolide glycoside (CHEBI:38092) |
| Synonyms | Source |
|---|---|
| Sarmentologenin 3-O-(6-deoxy-alpha-L-taloside) | KEGG COMPOUND |
| Sarmentoloside | KEGG COMPOUND |