EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35N7O2S |
| Net Charge | 0 |
| Average Mass | 509.680 |
| Monoisotopic Mass | 509.25729 |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C26H35N7O2S/c1-19-18-27-25(29-20-9-11-22(12-10-20)33-15-13-32(5)14-16-33)30-24(19)28-21-7-6-8-23(17-21)36(34,35)31-26(2,3)4/h6-12,17-18,31H,13-16H2,1-5H3,(H2,27,28,29,30) |
| InChIKey | JVDOKQYTTYUYDV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TG101209 (CHEBI:90304) has role antineoplastic agent (CHEBI:35610) |
| TG101209 (CHEBI:90304) has role apoptosis inducer (CHEBI:68495) |
| TG101209 (CHEBI:90304) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| TG101209 (CHEBI:90304) is a N-alkylpiperazine (CHEBI:46845) |
| TG101209 (CHEBI:90304) is a N-arylpiperazine (CHEBI:46848) |
| TG101209 (CHEBI:90304) is a pyrimidines (CHEBI:39447) |
| TG101209 (CHEBI:90304) is a secondary amino compound (CHEBI:50995) |
| TG101209 (CHEBI:90304) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-tert-butyl-3-[(5-methyl-2-{[4-(4-methylpiperazin-1-yl)phenyl]amino}pyrimidin-4-yl)amino]benzenesulfonamide |
| Synonyms | Source |
|---|---|
| TG 101209 | ChEBI |
| TG-101209 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12903888 | Reaxys |
| Citations |
|---|