EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14ClF2N3O3S |
| Net Charge | 0 |
| Average Mass | 413.833 |
| Monoisotopic Mass | 413.04125 |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2cnc3ncc(Cl)cc23)c1F |
| InChI | InChI=1S/C17H14ClF2N3O3S/c1-2-5-27(25,26)23-13-4-3-12(19)14(15(13)20)16(24)11-8-22-17-10(11)6-9(18)7-21-17/h3-4,6-8,23H,2,5H2,1H3,(H,21,22) |
| InChIKey | YZDJQTHVDDOVHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PLX-4720 (CHEBI:90295) has role antineoplastic agent (CHEBI:35610) |
| PLX-4720 (CHEBI:90295) has role B-Raf inhibitor (CHEBI:75047) |
| PLX-4720 (CHEBI:90295) is a aromatic ketone (CHEBI:76224) |
| PLX-4720 (CHEBI:90295) is a difluorobenzene (CHEBI:38582) |
| PLX-4720 (CHEBI:90295) is a organochlorine compound (CHEBI:36683) |
| PLX-4720 (CHEBI:90295) is a pyrrolopyridine (CHEBI:46771) |
| PLX-4720 (CHEBI:90295) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-{3-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)carbonyl]-2,4-difluorophenyl}propane-1-sulfonamide |
| Synonyms | Source |
|---|---|
| N-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorophenyl]propane-1-sulfonamide | ChemIDplus |
| PLX 4720 | ChemIDplus |
| PLX4720 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12833018 | Reaxys |
| CAS:918505-84-7 | ChemIDplus |
| Citations |
|---|