EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15O4R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 259.278 |
| Monoisotopic Mass (excl. R groups) | 259.09703 |
| SMILES | *OCC1=CC(=O)C2=C(C)CC[C@@]3([H])C(=C)C(=O)O[C@]3([H])[C@@]12[H] |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cichorium intybus (ncbitaxon:13427) | - | MetaboLights (MTBLS270) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) has functional parent lactucin (CHEBI:6358) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) has role plant metabolite (CHEBI:76924) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) is a azulenofuran (CHEBI:39433) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) is a cyclic terpene ketone (CHEBI:36130) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) is a enone (CHEBI:51689) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) is a sesquiterpene lactone (CHEBI:37667) |
| 8-deoxylactucin-15-glycoside (CHEBI:90273) is a terpene glycoside (CHEBI:61777) |
| Synonym | Source |
|---|---|
| 15-glycosyl-8-deoxylactucin | ChEBI |