EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O8 |
| Net Charge | 0 |
| Average Mass | 350.323 |
| Monoisotopic Mass | 350.10017 |
| SMILES | [H][C@]12C(COC(=O)C(=O)O)=CC(=O)C1=C(C)C[C@H](O)[C@@]1([H])C(C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C17H18O8/c1-6-3-9(18)12-7(2)16(22)25-14(12)13-8(4-10(19)11(6)13)5-24-17(23)15(20)21/h4,7,9,12-14,18H,3,5H2,1-2H3,(H,20,21)/t7?,9-,12+,13-,14-/m0/s1 |
| InChIKey | ZIRFGNHEXDKBIN-WMNLTVTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cichorium intybus (ncbitaxon:13427) | - | MetaboLights (MTBLS270) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) has functional parent lactucin (CHEBI:6358) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) has functional parent oxalic acid (CHEBI:16995) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) has role plant metabolite (CHEBI:76924) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) is a azulenofuran (CHEBI:39433) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) is a cyclic terpene ketone (CHEBI:36130) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) is a enone (CHEBI:51689) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) is a oxo monocarboxylic acid (CHEBI:35871) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) is a secondary alcohol (CHEBI:35681) |
| 11β,13-dihydrolactucin 15-oxalate (CHEBI:90270) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| {[(3S,3aR,4S,9aS,9bR)-4-hydroxy-3,6-dimethyl-2,7-dioxo-2,3,3a,4,5,7,9a,9b-octahydroazuleno[4,5-b]furan-9-yl]methoxy}(oxo)acetic acid |
| Synonyms | Source |
|---|---|
| 11,13-dihydrolactucin 15-oxalate | ChEBI |
| 15-oxalyl-11β,13-dihydrolactucin | ChEBI |