EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5ClO4 |
| Net Charge | 0 |
| Average Mass | 152.533 |
| Monoisotopic Mass | 151.98764 |
| SMILES | O=C(O)CC(Cl)C(=O)O |
| InChI | InChI=1S/C4H5ClO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9) |
| InChIKey | QEGKXSHUKXMDRW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS225) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chlorosuccinic acid (CHEBI:90244) has functional parent succinic acid (CHEBI:15741) |
| 2-chlorosuccinic acid (CHEBI:90244) is a C4-dicarboxylic acid (CHEBI:66873) |
| 2-chlorosuccinic acid (CHEBI:90244) is a chlorocarboxylic acid (CHEBI:36685) |
| 2-chlorosuccinic acid (CHEBI:90244) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| 2-chlorobutanedioic acid |
| Synonym | Source |
|---|---|
| Chlorosuccinic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-8933 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723551 | Reaxys |
| CAS:16045-92-4 | ChemIDplus |