EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O7S |
| Net Charge | 0 |
| Average Mass | 260.223 |
| Monoisotopic Mass | 259.99907 |
| SMILES | O=C(O)/C=C/c1ccc(O)c(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H8O7S/c10-7-3-1-6(2-4-9(11)12)5-8(7)16-17(13,14)15/h1-5,10H,(H,11,12)(H,13,14,15)/b4-2+ |
| InChIKey | VWQNTRNACRFUCQ-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (20842300) | |
| Phyllanthus niruri (ncbitaxon:296034) | - | MetaboLights (MTBLS224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caffeic acid 3-sulfate (CHEBI:90242) has functional parent trans-caffeic acid (CHEBI:16433) |
| caffeic acid 3-sulfate (CHEBI:90242) has role human blood serum metabolite (CHEBI:85234) |
| caffeic acid 3-sulfate (CHEBI:90242) has role human urinary metabolite (CHEBI:84087) |
| caffeic acid 3-sulfate (CHEBI:90242) has role human xenobiotic metabolite (CHEBI:76967) |
| caffeic acid 3-sulfate (CHEBI:90242) is a aryl sulfate (CHEBI:37919) |
| caffeic acid 3-sulfate (CHEBI:90242) is a monohydroxycinnamic acid (CHEBI:24688) |
| caffeic acid 3-sulfate (CHEBI:90242) is conjugate acid of caffeic acid 3-sulfate(2−) (CHEBI:133740) |
| Incoming Relation(s) |
| caffeic acid 3-sulfate(2−) (CHEBI:133740) is conjugate base of caffeic acid 3-sulfate (CHEBI:90242) |
| IUPAC Name |
|---|
| (2E)-3-[4-hydroxy-3-(sulfooxy)phenyl]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| caffeic acid 3'-O-sulfate | ChEBI |
| caffeic acid 3-O-sulfate | ChEBI |
| caffeic acid 3'-sulfate | ChEBI |
| caffeic acid 3-sulphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041706 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6603942 | Reaxys |
| Citations |
|---|