EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H54F2N4O8 |
| Net Charge | 0 |
| Average Mass | 816.943 |
| Monoisotopic Mass | 816.39097 |
| SMILES | [H][C@@]1(C(C)(F)F)C[C@@H]2CN(Cc3c(nc4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N(C)[C@@]3([H])[C@@](O)(C(=O)OC)[C@]([H])(OC(C)=O)[C@]5(CC)C=CCN6CC[C@]43[C@@H]65)C2)C1 |
| InChI | InChI=1S/C45H54F2N4O8/c1-8-42-14-11-16-51-17-15-43(36(42)51)30-19-31(34(56-5)20-33(30)49(4)37(43)45(55,40(54)58-7)38(42)59-25(2)52)44(39(53)57-6)21-26-18-27(41(3,46)47)23-50(22-26)24-29-28-12-9-10-13-32(28)48-35(29)44/h9-14,19-20,26-27,36-38,48,55H,8,15-18,21-24H2,1-7H3/t26-,27+,36-,37+,38+,42+,43+,44-,45-/m0/s1 |
| InChIKey | NMDYYWFGPIMTKO-KLCPSUAYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinflunine (CHEBI:90241) has functional parent vinorelbine (CHEBI:480999) |
| vinflunine (CHEBI:90241) has role antineoplastic agent (CHEBI:35610) |
| vinflunine (CHEBI:90241) is a acetate ester (CHEBI:47622) |
| vinflunine (CHEBI:90241) is a methyl ester (CHEBI:25248) |
| vinflunine (CHEBI:90241) is a organic heteropentacyclic compound (CHEBI:38164) |
| vinflunine (CHEBI:90241) is a organic heterotetracyclic compound (CHEBI:38163) |
| vinflunine (CHEBI:90241) is a semisynthetic derivative (CHEBI:72588) |
| vinflunine (CHEBI:90241) is a vinca alkaloid (CHEBI:27288) |
| IUPAC Name |
|---|
| methyl (2β,3β,4β,5α,12β,19α)-4-(acetyloxy)-15-[(12S,14S,16R)-16-(1,1-difluoroethyl)-12-(methoxycarbonyl)-1,10-diazatetracyclo[12.3.1.03,11.04,9]octadeca-3(11),4,6,8-tetraen-12-yl]-3-hydroxy-16-methoxy-1-methyl-6,7-didehydroaspidospermidine-3-carboxylate |
| INNs | Source |
|---|---|
| vinflunine | WHO MedNet |
| vinflunina | WHO MedNet |
| vinfluninum | WHO MedNet |
| vinflunine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4'-deoxy-20',20'-difluoro-5'-norvincaleukoblastine | ChEBI |
| 4'-deoxy-20',20'-difluoro-8'-norvincaleukoblastine | ChEBI |
| 20',20'-difluoro-3',4'-dihydrovinorelbine | ChEBI |
| Brand Name | Source |
|---|---|
| Javlor | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Vinflunine | Wikipedia |
| 3644 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15644716 | Reaxys |
| CAS:162652-95-1 | ChemIDplus |
| Citations |
|---|