EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3 |
| InChIKey | DWZAJFZEYZIHPO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| santin (CHEBI:9024) has functional parent flavone (CHEBI:42491) |
| santin (CHEBI:9024) has role plant metabolite (CHEBI:76924) |
| santin (CHEBI:9024) is a dihydroxyflavone (CHEBI:38686) |
| santin (CHEBI:9024) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5,7-dihydroxy-3,6,4'-trimethoxy flavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10180 | KEGG COMPOUND |
| C00001096 | KNApSAcK |
| LMPK12112861 | LIPID MAPS |
| Santin_(flavonol) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1355698 | Reaxys |
| CAS:27782-63-4 | KEGG COMPOUND |