EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N6O4 |
| Net Charge | 0 |
| Average Mass | 562.715 |
| Monoisotopic Mass | 562.32675 |
| SMILES | COc1cc2c(N3CCN(C(=O)Nc4ccc(OC(C)C)cc4)CC3)ncnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C31H42N6O4/c1-23(2)41-25-10-8-24(9-11-25)34-31(38)37-17-15-36(16-18-37)30-26-20-28(39-3)29(21-27(26)32-22-33-30)40-19-7-14-35-12-5-4-6-13-35/h8-11,20-23H,4-7,12-19H2,1-3H3,(H,34,38) |
| InChIKey | UXXQOJXBIDBUAC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tandutinib (CHEBI:90237) has role antineoplastic agent (CHEBI:35610) |
| tandutinib (CHEBI:90237) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| tandutinib (CHEBI:90237) is a N-arylpiperazine (CHEBI:46848) |
| tandutinib (CHEBI:90237) is a N-carbamoylpiperazine (CHEBI:46919) |
| tandutinib (CHEBI:90237) is a aromatic ether (CHEBI:35618) |
| tandutinib (CHEBI:90237) is a phenylureas (CHEBI:134043) |
| tandutinib (CHEBI:90237) is a piperidines (CHEBI:26151) |
| tandutinib (CHEBI:90237) is a quinazolines (CHEBI:38530) |
| tandutinib (CHEBI:90237) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-{6-methoxy-7-[3-(piperidin-1-yl)propoxy]quinazolin-4-yl}-N-[4-(propan-2-yloxy)phenyl]piperazine-1-carboxamide |
| INNs | Source |
|---|---|
| tandutinib | WHO MedNet |
| tandutinibum | WHO MedNet |
| tandutinib | WHO MedNet |
| tandutinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CT-53518 | ChEBI |
| MLN-518 | ChEBI |
| MLN518 | ChEBI |
| CT53518 | ChemIDplus |
| (4-(6-methoxy-7-(3-piperidylpropoxy)quinazolin-4-yl)piperazinyl)-N-(4-(methylethoxy)phenyl)carboxamide | ChemIDplus |
| CT 53518 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9241203 | Reaxys |
| CAS:387867-13-2 | ChemIDplus |
| Citations |
|---|