EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33N3O6S2 |
| Net Charge | 0 |
| Average Mass | 487.644 |
| Monoisotopic Mass | 487.18108 |
| SMILES | [H][C@]1([C@@H](C)CC)NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@]([H])(C)C(=O)N2)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C21H33N3O6S2/c1-4-12(2)19-16(25)10-18(27)30-14-7-5-6-8-31-32-11-15(21(29)24-19)23-20(28)13(3)22-17(26)9-14/h5,7,12-16,19,25H,4,6,8-11H2,1-3H3,(H,22,26)(H,23,28)(H,24,29)/b7-5+/t12-,13+,14+,15+,16-,19+/m0/s1 |
| InChIKey | MJHZJODQLYCXHE-WXZCCWHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas (ncbitaxon:286) | - | Article (Y. Masuoka, A. Nagai, K. Shin-ya, K. Furihata, K. Nagai, K. Suzuki, Y. Hayakawa, H. Seto, Tetrahedron Lett. 2001 , 42 , 41–44) | isolated from culture broth |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiruchostatin B (CHEBI:90235) has role antineoplastic agent (CHEBI:35610) |
| spiruchostatin B (CHEBI:90235) has role bacterial metabolite (CHEBI:76969) |
| spiruchostatin B (CHEBI:90235) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| spiruchostatin B (CHEBI:90235) is a macrocyclic lactone (CHEBI:63944) |
| spiruchostatin B (CHEBI:90235) is a organic disulfide (CHEBI:35489) |
| spiruchostatin B (CHEBI:90235) is a organic heterobicyclic compound (CHEBI:27171) |
| spiruchostatin B (CHEBI:90235) is a spiruchostatin (CHEBI:90234) |
| IUPAC Name |
|---|
| (1S,5S,6R,9S,15E,20R)-6-[(2S)-butan-2-yl]-5-hydroxy-20-methyl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
| Synonym | Source |
|---|---|
| (−)-spiruchostatin B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18598407 | Reaxys |
| Citations |
|---|