EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O |
| Net Charge | 0 |
| Average Mass | 205.221 |
| Monoisotopic Mass | 205.09636 |
| SMILES | Nc1ncnc2c1ncn2C1CCCO1 |
| InChI | InChI=1S/C9H11N5O/c10-8-7-9(12-4-11-8)14(5-13-7)6-2-1-3-15-6/h4-6H,1-3H2,(H2,10,11,12) |
| InChIKey | UKHMZCMKHPHFOT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 4.6.1.1 (adenylate cyclase) inhibitor An EC 4.6.* (P‒O lyase) inhibitor that interferes with the action of enzyme adenylate cyclase (EC 4.6.1.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(tetrahydrofuryl)adenine (CHEBI:90232) has functional parent adenine (CHEBI:16708) |
| 9-(tetrahydrofuryl)adenine (CHEBI:90232) has role EC 4.6.1.1 (adenylate cyclase) inhibitor (CHEBI:90365) |
| 9-(tetrahydrofuryl)adenine (CHEBI:90232) is a nucleoside analogue (CHEBI:60783) |
| 9-(tetrahydrofuryl)adenine (CHEBI:90232) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| 9-(tetrahydrofuran-2-yl)-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 6-amino-9-(tetrahydro-2-furyl)-9H-purine | ChemIDplus |
| 9-(tetrahydro-2-furanyl)-9H-purin-6-amine | ChEBI |
| 9-(tetrahydro-2-furyl)-adenine | ChEBI |
| SQ 22,536 | ChemIDplus |
| SQ 22536 | ChemIDplus |
| SQ-22536 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1656 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:534250 | Reaxys |
| CAS:17318-31-9 | ChemIDplus |
| Citations |
|---|