EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H36N4O6 |
| Net Charge | 0 |
| Average Mass | 608.695 |
| Monoisotopic Mass | 608.26348 |
| SMILES | C=CC1=C(C)/C2=C/C3=N/C(=C4\c5nc(c(C)c5C(=O)[C@@H]4C(=O)OC)/C=C4\N=C(C(C)=C4CC)C4OC14N2)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C35H36N4O6/c1-8-18-15(4)29-33-35(45-33)20(9-2)16(5)23(39-35)12-21-14(3)19(10-11-25(40)41)30(36-21)27-28(34(43)44-7)32(42)26-17(6)22(37-31(26)27)13-24(18)38-29/h9,12-14,19,28,33,37,39H,2,8,10-11H2,1,3-7H3,(H,40,41)/b23-12-,24-13-,30-27-/t14-,19-,28+,33?,35?/m0/s1 |
| InChIKey | ICQNLVYDPRIQAA-UJSYQKIMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epoxypheophorbide a (CHEBI:90228) has functional parent pheophorbide a (CHEBI:38257) |
| epoxypheophorbide a (CHEBI:90228) is a epoxide (CHEBI:32955) |
| epoxypheophorbide a (CHEBI:90228) is a pheophorbide (CHEBI:38254) |
| epoxypheophorbide a (CHEBI:90228) is conjugate acid of epoxypheophorbide a(1−) (CHEBI:88233) |
| Incoming Relation(s) |
| epoxypheophorbide a(1−) (CHEBI:88233) is conjugate base of epoxypheophorbide a (CHEBI:90228) |
| IUPAC Name |
|---|
| 3-[(3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3,4,20,21,23,25-hexahydro-11H-phorbin-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-18666 | MetaCyc |