EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15BrClFN4O3 |
| Net Charge | 0 |
| Average Mass | 457.687 |
| Monoisotopic Mass | 456.00001 |
| SMILES | Cn1cnc2c(F)c(Nc3ccc(Br)cc3Cl)c(C(=O)NOCCO)cc21 |
| InChI | InChI=1S/C17H15BrClFN4O3/c1-24-8-21-16-13(24)7-10(17(26)23-27-5-4-25)15(14(16)20)22-12-3-2-9(18)6-11(12)19/h2-3,6-8,22,25H,4-5H2,1H3,(H,23,26) |
| InChIKey | CYOHGALHFOKKQC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selumetinib (CHEBI:90227) has role anticoronaviral agent (CHEBI:149553) |
| selumetinib (CHEBI:90227) has role antineoplastic agent (CHEBI:35610) |
| selumetinib (CHEBI:90227) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| selumetinib (CHEBI:90227) is a benzimidazoles (CHEBI:22715) |
| selumetinib (CHEBI:90227) is a bromobenzenes (CHEBI:37149) |
| selumetinib (CHEBI:90227) is a hydroxamic acid ester (CHEBI:75606) |
| selumetinib (CHEBI:90227) is a monochlorobenzenes (CHEBI:83403) |
| selumetinib (CHEBI:90227) is a organofluorine compound (CHEBI:37143) |
| selumetinib (CHEBI:90227) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-[(4-bromo-2-chlorophenyl)amino]-4-fluoro-N-(2-hydroxyethoxy)-1-methyl-1H-benzimidazole-6-carboxamide |
| INNs | Source |
|---|---|
| selumetinib | WHO MedNet |
| selumetinibum | WHO MedNet |
| sélumétinib | WHO MedNet |
| selumetinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ARRY-142886 | ChemIDplus |
| ARRY 142886 | ChemIDplus |
| AZD6244 | ChemIDplus |
| AZD 6244 | ChemIDplus |
| AZD-6244 | ChEBI |
| ARRY142886 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Selumetinib | Wikipedia |
| D09666 | KEGG DRUG |
| 3EW | PDBeChem |
| LSM-1056 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11099648 | Reaxys |
| CAS:606143-52-6 | ChemIDplus |
| Citations |
|---|