EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H43F5O5S |
| Net Charge | 0 |
| Average Mass | 658.770 |
| Monoisotopic Mass | 658.27514 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])[C@@H](c1ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1)C[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C34H43F5O5S/c1-32-21-28(31-26-13-9-24(40)20-23(26)8-12-27(31)29(32)14-15-30(32)41)22-6-10-25(11-7-22)44-17-3-2-4-18-45(42,43)19-5-16-33(35,36)34(37,38)39/h6-7,9-11,13,20,27-31,40-41H,2-5,8,12,14-19,21H2,1H3/t27-,28+,29-,30-,31+,32-/m0/s1 |
| InChIKey | SDCUWFRXMLQNCS-LFAPAAFUSA-N |
| Roles Classification |
|---|
| Biological Role: | estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | estrogen receptor antagonist An antagonist at the estrogen receptor. anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RU 58668 (CHEBI:90223) has role anti-estrogen (CHEBI:50751) |
| RU 58668 (CHEBI:90223) has role antineoplastic agent (CHEBI:35610) |
| RU 58668 (CHEBI:90223) has role estrogen receptor antagonist (CHEBI:50792) |
| RU 58668 (CHEBI:90223) is a 17β-hydroxy steroid (CHEBI:35343) |
| RU 58668 (CHEBI:90223) is a 3-hydroxy steroid (CHEBI:36834) |
| RU 58668 (CHEBI:90223) is a aromatic ether (CHEBI:35618) |
| RU 58668 (CHEBI:90223) is a organofluorine compound (CHEBI:37143) |
| RU 58668 (CHEBI:90223) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 11β-[4-({5-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]pentyl}oxy)phenyl]estra-1,3,5(10)-triene-3,17β-diol |
| Synonyms | Source |
|---|---|
| RU-58668 | ChEBI |
| RU 58,668 | ChEBI |
| RU 58 668 | ChemIDplus |
| RU58668 | ChemIDplus |
| 11β-[4-({5-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]pentyl}oxy)phenyl]-17β-estradiol | ChEBI |
| (11β,17β)-11-[4-({5-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]pentyl}oxy)phenyl]estra-1,3,5(10)-triene-3,17-diol | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7454158 | Reaxys |
| CAS:151555-47-4 | ChemIDplus |
| Citations |
|---|