EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H43F5O5S |
| Net Charge | 0 |
| Average Mass | 658.770 |
| Monoisotopic Mass | 658.27514 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])[C@@H](c1ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1)C[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C34H43F5O5S/c1-32-21-28(31-26-13-9-24(40)20-23(26)8-12-27(31)29(32)14-15-30(32)41)22-6-10-25(11-7-22)44-17-3-2-4-18-45(42,43)19-5-16-33(35,36)34(37,38)39/h6-7,9-11,13,20,27-31,40-41H,2-5,8,12,14-19,21H2,1H3/t27-,28+,29-,30-,31+,32-/m0/s1 |
| InChIKey | SDCUWFRXMLQNCS-LFAPAAFUSA-N |
| Roles Classification |
|---|
| Biological Role: | estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RU 58668 (CHEBI:90223) has role anti-estrogen (CHEBI:50751) |
| RU 58668 (CHEBI:90223) has role antineoplastic agent (CHEBI:35610) |
| RU 58668 (CHEBI:90223) has role estrogen receptor antagonist (CHEBI:50792) |
| RU 58668 (CHEBI:90223) is a 17β-hydroxy steroid (CHEBI:35343) |
| RU 58668 (CHEBI:90223) is a 3-hydroxy steroid (CHEBI:36834) |
| RU 58668 (CHEBI:90223) is a aromatic ether (CHEBI:35618) |
| RU 58668 (CHEBI:90223) is a organofluorine compound (CHEBI:37143) |
| RU 58668 (CHEBI:90223) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 11β-[4-({5-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]pentyl}oxy)phenyl]estra-1,3,5(10)-triene-3,17β-diol |
| Synonyms | Source |
|---|---|
| (11β,17β)-11-[4-({5-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]pentyl}oxy)phenyl]estra-1,3,5(10)-triene-3,17-diol | IUPAC |
| 11β-[4-({5-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]pentyl}oxy)phenyl]-17β-estradiol | ChEBI |
| RU 58 668 | ChemIDplus |
| RU 58,668 | ChEBI |
| RU-58668 | ChEBI |
| RU58668 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7454158 | Reaxys |
| CAS:151555-47-4 | ChemIDplus |
| Citations |
|---|