EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H10Br2HgO6 |
| Net Charge | 0 |
| Average Mass | 706.692 |
| Monoisotopic Mass | 705.85506 |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Br)c(=O)cc-2oc2[c]([Hg][OH])c(O)c(Br)cc12 |
| InChI | InChI=1S/C20H9Br2O5.Hg.H2O/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26;;/h1-7,24H,(H,25,26);;1H2/q;+1;/p-1 |
| InChIKey | OHCFGBLQZMYRTR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) has functional parent fluorescein (lactone form) (CHEBI:31624) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) has role antiseptic drug (CHEBI:48218) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) has role fluorochrome (CHEBI:51217) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) has role histological dye (CHEBI:77178) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) is a arylmercury compound (CHEBI:22648) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) is a benzoic acids (CHEBI:22723) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) is a organobromine compound (CHEBI:37141) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) is a xanthene dye (CHEBI:37929) |
| 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) is conjugate acid of 2,7-dibromo-4-hydroxymercurifluorescein(2−) (CHEBI:90220) |
| Incoming Relation(s) |
| 2,7-dibromo-4-hydroxymercurifluorescein(2−) (CHEBI:90220) is conjugate base of 2,7-dibromo-4-hydroxymercurifluorescein (CHEBI:90221) |
| IUPAC Name |
|---|
| [2,7-dibromo-9-(2-carboxyphenyl)-6-hydroxy-3-oxo-3H-xanthen-5-yl](hydroxy)mercury |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24643996 | Reaxys |