EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32N6O4S |
| Net Charge | 0 |
| Average Mass | 560.680 |
| Monoisotopic Mass | 560.22057 |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c(n3)sc3cc(OCCN5CCOCC5)ccc34)cc2)no1 |
| InChI | InChI=1S/C29H32N6O4S/c1-29(2,3)25-17-26(33-39-25)32-27(36)30-20-6-4-19(5-7-20)22-18-35-23-9-8-21(16-24(23)40-28(35)31-22)38-15-12-34-10-13-37-14-11-34/h4-9,16-18H,10-15H2,1-3H3,(H2,30,32,33,36) |
| InChIKey | CVWXJKQAOSCOAB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | necroptosis inhibitor Any substance that inhibits the process of necroptosis (programmed form of necrosis) in organisms. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quizartinib (CHEBI:90217) has role antineoplastic agent (CHEBI:35610) |
| quizartinib (CHEBI:90217) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| quizartinib (CHEBI:90217) has role necroptosis inhibitor (CHEBI:167704) |
| quizartinib (CHEBI:90217) is a benzoimidazothiazole (CHEBI:48904) |
| quizartinib (CHEBI:90217) is a isoxazoles (CHEBI:55373) |
| quizartinib (CHEBI:90217) is a morpholines (CHEBI:38785) |
| quizartinib (CHEBI:90217) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-{7-[2-(morpholin-4-yl)ethoxy]imidazo[2,1-b][1,3]benzothiazol-2-yl}phenyl)urea |
| INNs | Source |
|---|---|
| quizartinib | WHO MedNet |
| quizartinib | WHO MedNet |
| quizartinib | WHO MedNet |
| quizartinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AC 010220 | ChemIDplus |
| AC010220 | ChemIDplus |
| AC 220 | ChemIDplus |
| AC220 | ChemIDplus |
| N-(5-(1,1-Dimethylethyl)isoxazol-3-yl)-N'-(4-(7-(2-(morpholin-4-yl)ethoxy)imidazo(2,1-b)benzothiazol-2-yl)phenyl)urea | ChemIDplus |
| Brand Name | Source |
|---|---|
| Vanflyta | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D09955 | KEGG DRUG |
| HMDB0257064 | HMDB |
| LSM-1037 | LINCS |
| P30 | PDBeChem |
| Quizartinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12981016 | Reaxys |
| CAS:950769-58-1 | ChemIDplus |
| Citations |
|---|