EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N4O8S2.2Na |
| Net Charge | 0 |
| Average Mass | 524.444 |
| Monoisotopic Mass | 524.00484 |
| SMILES | CC(=O)Nc1ccc(N=Nc2c(N)ccc3cc(S(=O)(=O)[O-])cc(O)c23)c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H16N4O8S2.2Na/c1-9(23)20-11-3-5-14(16(7-11)32(28,29)30)21-22-18-13(19)4-2-10-6-12(31(25,26)27)8-15(24)17(10)18;;/h2-8,24H,19H2,1H3,(H,20,23)(H,25,26,27)(H,28,29,30);;/q;2*+1/p-2 |
| InChIKey | YAGIKUGDXINHLL-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine fast red (CHEBI:90200) has part lissamine fast red(2−) (CHEBI:90202) |
| lissamine fast red (CHEBI:90200) has role fluorochrome (CHEBI:51217) |
| lissamine fast red (CHEBI:90200) has role histological dye (CHEBI:77178) |
| lissamine fast red (CHEBI:90200) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5-[(4-acetamido-2-sulfonatophenyl)diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonate |
| Synonyms | Source |
|---|---|
| acid red 37 | ChEBI |
| C.I. 17045 | ChEBI |
| Disodium 5-((4-acetylamino-2-sulphophenyl)azo)-6-amino-4-hydroxynaphthalene-2-disulphonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4109680 | Reaxys |
| CAS:6360-07-2 | ChemIDplus |
| Citations |
|---|