EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H34Cl2N4O4S |
| Net Charge | 0 |
| Average Mass | 641.621 |
| Monoisotopic Mass | 640.16778 |
| SMILES | [H][C@]1(CN2CCCC2)CCCN1C(=O)c1c(C)nc(/C=C2\C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)c1C |
| InChI | InChI=1S/C32H34Cl2N4O4S/c1-19-29(35-20(2)30(19)32(40)38-14-6-7-21(38)17-37-12-3-4-13-37)16-24-23-15-22(10-11-28(23)36-31(24)39)43(41,42)18-25-26(33)8-5-9-27(25)34/h5,8-11,15-16,21,35H,3-4,6-7,12-14,17-18H2,1-2H3,(H,36,39)/b24-16-/t21-/m1/s1 |
| InChIKey | OYONTEXKYJZFHA-SSHUPFPWSA-N |
| Roles Classification |
|---|
| Biological Role: | c-Met tyrosine kinase inhibitor An EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor that interferes with the action of c-Met tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PHA-665752 (CHEBI:90197) has role antineoplastic agent (CHEBI:35610) |
| PHA-665752 (CHEBI:90197) has role c-Met tyrosine kinase inhibitor (CHEBI:90199) |
| PHA-665752 (CHEBI:90197) is a N-acylpyrrolidine (CHEBI:46766) |
| PHA-665752 (CHEBI:90197) is a dichlorobenzene (CHEBI:23697) |
| PHA-665752 (CHEBI:90197) is a enamide (CHEBI:51751) |
| PHA-665752 (CHEBI:90197) is a indolones (CHEBI:24829) |
| PHA-665752 (CHEBI:90197) is a pyrrolecarboxamide (CHEBI:48611) |
| PHA-665752 (CHEBI:90197) is a secondary carboxamide (CHEBI:140325) |
| PHA-665752 (CHEBI:90197) is a sulfone (CHEBI:35850) |
| PHA-665752 (CHEBI:90197) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (3Z)-5-[(2,6-dichlorobenzyl)sulfonyl]-3-[(3,5-dimethyl-4-{[(2R)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]carbonyl}-1H-pyrrol-2-yl)methylidene]-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| PHA 665752 | ChEBI |
| PHA665752 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| PFY | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14491744 | Reaxys |
| CAS:477575-56-7 | ChemIDplus |
| Citations |
|---|