EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H17NO13 |
| Net Charge | 0 |
| Average Mass | 539.405 |
| Monoisotopic Mass | 539.06999 |
| SMILES | NC(Cc1ccc(O)c(-c2c(O)c(O)c3c(c2O)C(=O)c2c(cc(O)c(C(=O)O)c2C(=O)O)C3=O)c1)C(=O)O |
| InChI | InChI=1S/C25H17NO13/c26-9(23(34)35)4-6-1-2-10(27)7(3-6)13-20(31)17-16(22(33)21(13)32)18(29)8-5-11(28)14(24(36)37)15(25(38)39)12(8)19(17)30/h1-3,5,9,27-28,31-33H,4,26H2,(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | VRXULZFQCGXCRV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laccaic acid C (CHEBI:90192) has role animal metabolite (CHEBI:75767) |
| laccaic acid C (CHEBI:90192) has role dye (CHEBI:37958) |
| laccaic acid C (CHEBI:90192) is a polyphenol (CHEBI:26195) |
| laccaic acid C (CHEBI:90192) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| laccaic acid C (CHEBI:90192) is a tricarboxylic acid (CHEBI:27093) |
| laccaic acid C (CHEBI:90192) is a α-amino acid (CHEBI:33704) |
| Incoming Relation(s) |
| LAC dye (CHEBI:90184) has part laccaic acid C (CHEBI:90192) |
| IUPAC Name |
|---|
| 7-[5-(2-amino-2-carboxyethyl)-2-hydroxyphenyl]-3,5,6,8-tetrahydroxy-9,10-dioxo-9,10-dihydroanthracene-1,2-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2687777 | Reaxys |