EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H16O12 |
| Net Charge | 0 |
| Average Mass | 496.380 |
| Monoisotopic Mass | 496.06418 |
| SMILES | O=C(O)c1c(O)cc2c(c1C(=O)O)C(=O)c1c(O)c(-c3cc(CCO)ccc3O)c(O)c(O)c1C2=O |
| InChI | InChI=1S/C24H16O12/c25-4-3-7-1-2-10(26)8(5-7)13-20(30)17-16(22(32)21(13)31)18(28)9-6-11(27)14(23(33)34)15(24(35)36)12(9)19(17)29/h1-2,5-6,25-27,30-32H,3-4H2,(H,33,34)(H,35,36) |
| InChIKey | BVLPXKYBBOURAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laccaic acid B (CHEBI:90188) has role animal metabolite (CHEBI:75767) |
| laccaic acid B (CHEBI:90188) has role dye (CHEBI:37958) |
| laccaic acid B (CHEBI:90188) is a oxo dicarboxylic acid (CHEBI:36145) |
| laccaic acid B (CHEBI:90188) is a polyphenol (CHEBI:26195) |
| laccaic acid B (CHEBI:90188) is a primary alcohol (CHEBI:15734) |
| laccaic acid B (CHEBI:90188) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| Incoming Relation(s) |
| LAC dye (CHEBI:90184) has part laccaic acid B (CHEBI:90188) |
| IUPAC Name |
|---|
| 3,5,6,8-tetrahydroxy-7-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-9,10-dioxo-9,10-dihydroanthracene-1,2-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2230802 | Reaxys |
| CAS:17249-00-2 | ChemIDplus |
| Citations |
|---|