EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H19NO12 |
| Net Charge | 0 |
| Average Mass | 537.433 |
| Monoisotopic Mass | 537.09073 |
| SMILES | CC(=O)NCCc1ccc(O)c(-c2c(O)c(O)c3c(c2O)C(=O)c2c(cc(O)c(C(=O)O)c2C(=O)O)C3=O)c1 |
| InChI | InChI=1S/C26H19NO12/c1-8(28)27-5-4-9-2-3-12(29)10(6-9)15-22(33)19-18(24(35)23(15)34)20(31)11-7-13(30)16(25(36)37)17(26(38)39)14(11)21(19)32/h2-3,6-7,29-30,33-35H,4-5H2,1H3,(H,27,28)(H,36,37)(H,38,39) |
| InChIKey | IHLWXZNPOVMUFQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.1.1.37 [DNA (cytosine-5-)-methyltransferase] inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of DNA (cytosine-5-)-methyltransferase (EC 2.1.1.37). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laccaic acid A (CHEBI:90186) has role animal metabolite (CHEBI:75767) |
| laccaic acid A (CHEBI:90186) has role dye (CHEBI:37958) |
| laccaic acid A (CHEBI:90186) has role EC 2.1.1.37 [DNA (cytosine-5-)-methyltransferase] inhibitor (CHEBI:90190) |
| laccaic acid A (CHEBI:90186) is a acetamide (CHEBI:27856) |
| laccaic acid A (CHEBI:90186) is a oxo dicarboxylic acid (CHEBI:36145) |
| laccaic acid A (CHEBI:90186) is a polyphenol (CHEBI:26195) |
| laccaic acid A (CHEBI:90186) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| Incoming Relation(s) |
| LAC dye (CHEBI:90184) has part laccaic acid A (CHEBI:90186) |
| IUPAC Name |
|---|
| 7-[5-(2-acetamidoethyl)-2-hydroxyphenyl]-3,5,6,8-tetrahydroxy-9,10-dioxo-9,10-dihydroanthracene-1,2-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2715209 | Reaxys |
| CAS:15979-35-8 | ChemIDplus |
| Citations |
|---|