EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O8 |
| Net Charge | 0 |
| Average Mass | 330.248 |
| Monoisotopic Mass | 330.03757 |
| SMILES | Cc1c(C(=O)O)c(O)cc2c1C(=O)c1c(O)cc(O)c(O)c1C2=O |
| InChI | InChI=1S/C16H10O8/c1-4-9-5(2-6(17)10(4)16(23)24)13(20)12-11(15(9)22)7(18)3-8(19)14(12)21/h2-3,17-19,21H,1H3,(H,23,24) |
| InChIKey | CXORMDKZEUMQHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kermesic acid (CHEBI:90183) has role animal metabolite (CHEBI:75767) |
| kermesic acid (CHEBI:90183) has role dye (CHEBI:37958) |
| kermesic acid (CHEBI:90183) is a monocarboxylic acid (CHEBI:25384) |
| kermesic acid (CHEBI:90183) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| kermesic acid (CHEBI:90183) is conjugate acid of kermesate (CHEBI:149530) |
| Incoming Relation(s) |
| kermesate (CHEBI:149530) is conjugate base of kermesic acid (CHEBI:90183) |
| IUPAC Name |
|---|
| 3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| kermes | ChEBI |
| natural red 3 | ChEBI |
| C.I. 75460 | ChEBI |
| 1-Methyl-2-carboxy-3,5,6,8-tetrahydroxyanthraquinone | ChemIDplus |
| C.I. Natural Red 3 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2776900 | Reaxys |
| CAS:18499-92-8 | ChemIDplus |
| Citations |
|---|