EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13BrN4O |
| Net Charge | 0 |
| Average Mass | 381.233 |
| Monoisotopic Mass | 380.02727 |
| SMILES | CC#CC(=O)Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C18H13BrN4O/c1-2-4-17(24)22-14-7-8-16-15(10-14)18(21-11-20-16)23-13-6-3-5-12(19)9-13/h3,5-11H,1H3,(H,22,24)(H,20,21,23) |
| InChIKey | BTYYWOYVBXILOJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) has role antineoplastic agent (CHEBI:35610) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) is a bromobenzenes (CHEBI:37149) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) is a quinazolines (CHEBI:38530) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) is a secondary carboxamide (CHEBI:140325) |
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide (CHEBI:90180) is a ynamide (CHEBI:51752) |
| IUPAC Name |
|---|
| N-{4-[(3-bromophenyl)amino]quinazolin-6-yl}but-2-ynamide |
| Synonyms | Source |
|---|---|
| CL-387,785 | ChEBI |
| CL-387785 | ChemIDplus |
| EKB-785 | ChemIDplus |
| EKI-785 | ChemIDplus |
| N-{4-[(3-bromophenyl)amino]-6-quinazolinyl}-2-butynamide | ChEBI |
| N-{4-[(m-bromophenyl)amino]-6-quinazolinyl}-2-butynamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9076651 | Reaxys |
| CAS:194423-06-8 | ChemIDplus |
| Citations |
|---|