EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N3.2Cl |
| Net Charge | 0 |
| Average Mass | 472.504 |
| Monoisotopic Mass | 471.22080 |
| SMILES | Cc1cc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc([N+](C)(C)C)cc2)ccc1N(C)C.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H35N3.2ClH/c1-20-19-23(13-18-26(20)29(4)5)27(21-9-14-24(15-10-21)28(2)3)22-11-16-25(17-12-22)30(6,7)8;;/h9-19H,1-8H3;2*1H/q+2;;/p-2 |
| InChIKey | FRCAGVUKJQCWBD-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodine green (CHEBI:90179) has part iodine green(2+) (CHEBI:90181) |
| iodine green (CHEBI:90179) has role fluorochrome (CHEBI:51217) |
| iodine green (CHEBI:90179) has role histological dye (CHEBI:77178) |
| iodine green (CHEBI:90179) is a iminium salt (CHEBI:35277) |
| iodine green (CHEBI:90179) is a organic chloride salt (CHEBI:36094) |
| iodine green (CHEBI:90179) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (4-{[4-(dimethylamino)-3-methylphenyl][4-(trimethylazaniumyl)phenyl]methylidene}cyclohexa-2,5-dien-1-ylidene)(dimethyl)ammonium dichloride |
| Synonym | Source |
|---|---|
| C.I. 42556 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:33231-00-4 | ChemIDplus |
| Citations |
|---|