EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N7O14P2 |
| Net Charge | 0 |
| Average Mass | 665.446 |
| Monoisotopic Mass | 665.12477 |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)CC=C1 |
| InChI | InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1-2,4,7-8,10-11,13-16,20-21,29-32H,3,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | QVQHBKNZCMZBKP-NNYOXOHSSA-N |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydro-β-NAD (CHEBI:90174) is a NAD (CHEBI:13389) |
| 6-hydro-β-NAD (CHEBI:90174) is a NAD(P)H (CHEBI:13392) |
| 6-hydro-β-NAD (CHEBI:90174) is conjugate acid of 6-hydro-β-NAD(2−) (CHEBI:88140) |
| Incoming Relation(s) |
| 6-hydro-β-NAD(2−) (CHEBI:88140) is conjugate base of 6-hydro-β-NAD (CHEBI:90174) |
| IUPAC Name |
|---|
| adenosine 5'-{3-[1-(3-carbamoyl-1,6-dihydropyridin-1-yl)-1,4-anhydro-D-ribitol-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 6-HNAD | ChEBI |
| 6-hydro-β-nicotinamide adenine dinucleotide | ChEBI |
| 6-NADH | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23703692 | Reaxys |