EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90173 - 6-hydro-β-NADP
| Formula | C21H30N7O17P3 |
| Net Charge | 0 |
| Average Mass | 745.425 |
| Monoisotopic Mass | 745.09110 |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](OP(=O)(O)O)[C@@H]3O)[C@@H](O)[C@H]2O)CC=C1 |
| InChI | InChI=1S/C21H30N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1-2,4,7-8,10-11,13-16,20-21,29-31H,3,5-6H2,(H2,23,32)(H,36,37)(H,38,39)(H2,22,24,25)(H2,33,34,35)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | UADKDCHYFVMAQG-NNYOXOHSSA-N |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydro-β-NADP (CHEBI:90173) is a NAD(P)H (CHEBI:13392) |
| 6-hydro-β-NADP (CHEBI:90173) is a NADP (CHEBI:25523) |
| 6-hydro-β-NADP (CHEBI:90173) is conjugate acid of 6-hydro-β-NADP(4−) (CHEBI:88139) |
| Incoming Relation(s) |
| 6-hydro-β-NADP(4−) (CHEBI:88139) is conjugate base of 6-hydro-β-NADP (CHEBI:90173) |
| IUPAC Name |
|---|
| 2'-O-phosphonoadenosine 5'-{3-[1-(3-carbamoyl-1,6-dihydropyridin-1-yl)-1,4-anhydro-D-ribitol-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 6-NADPH | ChEBI |
| 6-hydro-nicotinamide adenine dinucleotide phosphate | MetaCyc |
| 6-HNADP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-18084 | MetaCyc |
| Citations |
|---|