EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14As2N2O2.2Cl |
| Net Charge | 0 |
| Average Mass | 439.006 |
| Monoisotopic Mass | 437.88643 |
| SMILES | [Cl-].[Cl-].[NH3+]c1cc([As]=[As]c2ccc(O)c([NH3+])c2)ccc1O |
| InChI | InChI=1S/C12H12As2N2O2.2ClH/c15-9-5-7(1-3-11(9)17)13-14-8-2-4-12(18)10(16)6-8;;/h1-6,17-18H,15-16H2;2*1H |
| InChIKey | VLAXZGHHBIJLAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antisyphilitic drug A substance that is used in the treatment of syphilis. |
| Application: | antisyphilitic drug A substance that is used in the treatment of syphilis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsphenamine (CHEBI:9016) has part 3,3'-diarsene-1,2-diylbis(6-hydroxyanilinium) (CHEBI:50958) |
| arsphenamine (CHEBI:9016) has role antisyphilitic drug (CHEBI:36051) |
| arsphenamine (CHEBI:9016) is a diarsenes (CHEBI:50954) |
| arsphenamine (CHEBI:9016) is a hydrochloride (CHEBI:36807) |
| arsphenamine (CHEBI:9016) is a organoarsenic compound (CHEBI:33406) |
| IUPAC Name |
|---|
| 3,3'-(diarsene-1,2-diyl)bis(6-hydroxybenzenaminium) dichloride |
| Synonyms | Source |
|---|---|
| 3,3'-diamino-4,4'-dihydroxyarsenobenzene dihydrochloride | ChemIDplus |
| 4,4'-(1,2-diarsenediyl)bis(2-aminophenol) dihydrochloride | ChemIDplus |
| 4,4'-arsenobis(2-aminophenol) dihydrochloride | ChemIDplus |
| 4,4'-(diarsene-1,2-diyl)bis(2-aminophenol) dihydrochloride | IUPAC |
| 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | ChemIDplus |
| arsenphenolamine hydrochloride | ChemIDplus |